C19H14N2O4 — CID 1497032
N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]furan-2-carboxamide (PubChem CID 1497032) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1497032 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(-c2nc3ccccc3o2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C19H14N2O4/c1-23-15-9-8-12(19-21-13-5-2-3-6-16(13)25-19)11-14(15)20-18(22)17-7-4-10-24-17/h2-11H,1H3,(H,20,22) |
| InChIKey | ZHHUXZBFVUOAFA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |