C28H21NO6 — CID 28675580
N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide (PubChem CID 28675580) has the molecular formula C28H21NO6 and a molecular weight of 467.48 g/mol. Its IUPAC name is N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 28675580 |
| Molecular Formula | C28H21NO6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-3-(2-oxochromen-3-yl)benzamide |
| SMILES | COc1ccc(-c2ccc(CO)o2)cc1NC(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C28H21NO6/c1-33-26-11-9-19(25-12-10-21(16-30)34-25)15-23(26)29-27(31)20-7-4-6-17(13-20)22-14-18-5-2-3-8-24(18)35-28(22)32/h2-15,30H,16H2,1H3,(H,29,31) |
| InChIKey | DYPUEQVIEQDCJI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|