C21H17NO5 — CID 28669452
N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-1-benzofuran-2-carboxamide (PubChem CID 28669452) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 28669452 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(CO)o2)cc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H17NO5/c1-25-19-8-6-14(18-9-7-15(12-23)26-18)10-16(19)22-21(24)20-11-13-4-2-3-5-17(13)27-20/h2-11,23H,12H2,1H3,(H,22,24) |
| InChIKey | NUDSNDVBNKVAEZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |