C23H25NO5 — CID 28672946
4-[(2R)-butan-2-yl]oxy-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]benzamide (PubChem CID 28672946) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]oxy-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]benzamide.
| Compound Name | 4-[(2R)-butan-2-yl]oxy-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 28672946 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-[(2R)-butan-2-yl]oxy-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]benzamide |
| SMILES | CC[C@@H](C)Oc1ccc(C(=O)Nc2cc(-c3ccc(CO)o3)ccc2OC)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-4-15(2)28-18-8-5-16(6-9-18)23(26)24-20-13-17(7-11-22(20)27-3)21-12-10-19(14-25)29-21/h5-13,15,25H,4,14H2,1-3H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | AMLWLDJWCGAMST-OAHLLOKOSA-N |
| XLogP | 4.88 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |