C20H19NO4 — CID 28666764
N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-4-methylbenzamide (PubChem CID 28666764) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-4-methylbenzamide.
| Compound Name | N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 28666764 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-4-methylbenzamide |
| SMILES | COc1ccc(-c2ccc(CO)o2)cc1NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-13-3-5-14(6-4-13)20(23)21-17-11-15(7-9-19(17)24-2)18-10-8-16(12-22)25-18/h3-11,22H,12H2,1-2H3,(H,21,23) |
| InChIKey | WRUPOCLHOOHILO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |