C21H20N2O4S — CID 28686922
N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-4-methylbenzamide (PubChem CID 28686922) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-4-methylbenzamide.
| Compound Name | N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 28686922 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-4-methylbenzamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2ccc(C)cc2)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C21H20N2O4S/c1-13-3-5-14(6-4-13)20(25)23-21(28)22-15-7-9-17(19(11-15)26-2)18-10-8-16(12-24)27-18/h3-11,24H,12H2,1-2H3,(H2,22,23,25,28) |
| InChIKey | BVFRNOZXIDIWMY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|