C21H19ClN2O5S — CID 28688490
N-[[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 28688490) has the molecular formula C21H19ClN2O5S and a molecular weight of 446.91 g/mol. Its IUPAC name is N-[[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 28688490 |
| Molecular Formula | C21H19ClN2O5S |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-[[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(-c3ccc(CO)o3)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C21H19ClN2O5S/c1-27-18-7-3-12(9-19(18)28-2)20(26)24-21(30)23-13-4-6-15(16(22)10-13)17-8-5-14(11-25)29-17/h3-10,25H,11H2,1-2H3,(H2,23,24,26,30) |
| InChIKey | GGDYELIWVAYHKJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|