C20H15Cl3N2O4S — CID 28688129
3,5-dichloro-N-[[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 28688129) has the molecular formula C20H15Cl3N2O4S and a molecular weight of 485.78 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 28688129 |
| Molecular Formula | C20H15Cl3N2O4S |
| Molecular Weight | 485.78 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | 3,5-dichloro-N-[[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC(=S)Nc2ccc(Cl)c(-c3ccc(CO)o3)c2)cc1Cl |
| InChI | InChI=1S/C20H15Cl3N2O4S/c1-28-18-15(22)6-10(7-16(18)23)19(27)25-20(30)24-11-2-4-14(21)13(8-11)17-5-3-12(9-26)29-17/h2-8,26H,9H2,1H3,(H2,24,25,27,30) |
| InChIKey | SHIMBFLGDWLGTH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|