C23H24N2O7S — CID 28688517
N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 28688517) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 28688517 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C23H24N2O7S/c1-28-18-11-14(5-7-16(18)17-8-6-15(12-26)32-17)24-23(33)25-22(27)13-9-19(29-2)21(31-4)20(10-13)30-3/h5-11,26H,12H2,1-4H3,(H2,24,25,27,33) |
| InChIKey | WPWFTFWSNDUKCZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|