C22H22N2O6S — CID 17098464
N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-2,4-dimethoxybenzamide (PubChem CID 17098464) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17098464 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(-c3ccc(CO)o3)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O6S/c1-27-14-5-8-17(20(11-14)29-3)21(26)24-22(31)23-13-4-7-16(19(10-13)28-2)18-9-6-15(12-25)30-18/h4-11,25H,12H2,1-3H3,(H2,23,24,26,31) |
| InChIKey | SNBMBUXZJQKIAS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|