C20H17BrN2O4S — CID 28687069
2-bromo-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]benzamide (PubChem CID 28687069) has the molecular formula C20H17BrN2O4S and a molecular weight of 461.34 g/mol. Its IUPAC name is 2-bromo-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 28687069 |
| Molecular Formula | C20H17BrN2O4S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 2-bromo-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2ccccc2Br)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C20H17BrN2O4S/c1-26-18-10-12(6-8-15(18)17-9-7-13(11-24)27-17)22-20(28)23-19(25)14-4-2-3-5-16(14)21/h2-10,24H,11H2,1H3,(H2,22,23,25,28) |
| InChIKey | GYHPFACRYJDIKT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|