C20H17ClN2O3S — CID 28687213
4-chloro-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]carbamothioyl]benzamide (PubChem CID 28687213) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is 4-chloro-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 28687213 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4-chloro-N-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2ccc(Cl)cc2)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C20H17ClN2O3S/c1-12-10-15(6-8-17(12)18-9-7-16(11-24)26-18)22-20(27)23-19(25)13-2-4-14(21)5-3-13/h2-10,24H,11H2,1H3,(H2,22,23,25,27) |
| InChIKey | NPJXGRRMUVLABK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|