C18H13Cl2NO3 — CID 28667689
4-chloro-N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide (PubChem CID 28667689) has the molecular formula C18H13Cl2NO3 and a molecular weight of 362.21 g/mol. Its IUPAC name is 4-chloro-N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 28667689 |
| Molecular Formula | C18H13Cl2NO3 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 4-chloro-N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2ccc(CO)o2)c(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13Cl2NO3/c19-12-3-1-11(2-4-12)18(23)21-13-5-7-15(16(20)9-13)17-8-6-14(10-22)24-17/h1-9,22H,10H2,(H,21,23) |
| InChIKey | QUJVBQNOICWHQQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |