C18H13ClINO3 — CID 28667348
N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-iodobenzamide (PubChem CID 28667348) has the molecular formula C18H13ClINO3 and a molecular weight of 453.66 g/mol. Its IUPAC name is N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-iodobenzamide.
| Compound Name | N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 28667348 |
| Molecular Formula | C18H13ClINO3 |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | N-[3-chloro-4-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-iodobenzamide |
| SMILES | O=C(Nc1ccc(-c2ccc(CO)o2)c(Cl)c1)c1cccc(I)c1 |
| InChI | InChI=1S/C18H13ClINO3/c19-16-9-13(21-18(23)11-2-1-3-12(20)8-11)4-6-15(16)17-7-5-14(10-22)24-17/h1-9,22H,10H2,(H,21,23) |
| InChIKey | STCPESBXLCGCIQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|