C16H12ClNO3S — CID 28669155
N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]thiophene-2-carboxamide (PubChem CID 28669155) has the molecular formula C16H12ClNO3S and a molecular weight of 333.80 g/mol. Its IUPAC name is N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 28669155 |
| Molecular Formula | C16H12ClNO3S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccc(CO)o2)c1)c1cccs1 |
| InChI | InChI=1S/C16H12ClNO3S/c17-13-5-3-10(18-16(20)15-2-1-7-22-15)8-12(13)14-6-4-11(9-19)21-14/h1-8,19H,9H2,(H,18,20) |
| InChIKey | MFOGJTSXNBERFE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |