C21H20ClNO4 — CID 28675834
N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-ethylphenoxy)acetamide (PubChem CID 28675834) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-ethylphenoxy)acetamide.
| Compound Name | N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 28675834 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-2-(4-ethylphenoxy)acetamide |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc(Cl)c(-c3ccc(CO)o3)c2)cc1 |
| InChI | InChI=1S/C21H20ClNO4/c1-2-14-3-6-16(7-4-14)26-13-21(25)23-15-5-9-19(22)18(11-15)20-10-8-17(12-24)27-20/h3-11,24H,2,12-13H2,1H3,(H,23,25) |
| InChIKey | CCIUDTCSZKHGJT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |