C20H18BrNO5 — CID 28676197
2-(4-bromophenoxy)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]acetamide (PubChem CID 28676197) has the molecular formula C20H18BrNO5 and a molecular weight of 432.27 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 28676197 |
| Molecular Formula | C20H18BrNO5 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(Br)cc2)cc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C20H18BrNO5/c1-25-18-8-4-14(10-17(18)19-9-7-16(11-23)27-19)22-20(24)12-26-15-5-2-13(21)3-6-15/h2-10,23H,11-12H2,1H3,(H,22,24) |
| InChIKey | WIEYFOBMJNCLQD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |