C20H19NO5 — CID 28672057
N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-methoxybenzamide (PubChem CID 28672057) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-methoxybenzamide.
| Compound Name | N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 28672057 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(OC)c(-c3ccc(CO)o3)c2)c1 |
| InChI | InChI=1S/C20H19NO5/c1-24-15-5-3-4-13(10-15)20(23)21-14-6-8-18(25-2)17(11-14)19-9-7-16(12-22)26-19/h3-11,22H,12H2,1-2H3,(H,21,23) |
| InChIKey | OCQYENORUJACAL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |