C18H15ClN2O4 — CID 28675349
2-chloro-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]pyridine-3-carboxamide (PubChem CID 28675349) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 2-chloro-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 28675349 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-chloro-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccnc2Cl)cc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C18H15ClN2O4/c1-24-15-6-4-11(9-14(15)16-7-5-12(10-22)25-16)21-18(23)13-3-2-8-20-17(13)19/h2-9,22H,10H2,1H3,(H,21,23) |
| InChIKey | DHRITEJRLHERAP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|