C26H23NO5 — CID 28677525
N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-phenylmethoxybenzamide (PubChem CID 28677525) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 28677525 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-phenylmethoxybenzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(OCc3ccccc3)c2)cc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C26H23NO5/c1-30-24-12-10-20(15-23(24)25-13-11-22(16-28)32-25)27-26(29)19-8-5-9-21(14-19)31-17-18-6-3-2-4-7-18/h2-15,28H,16-17H2,1H3,(H,27,29) |
| InChIKey | LPISZKKKJSCPJL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |