C19H16BrNO4 — CID 28667412
3-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]benzamide (PubChem CID 28667412) has the molecular formula C19H16BrNO4 and a molecular weight of 402.24 g/mol. Its IUPAC name is 3-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]benzamide.
| Compound Name | 3-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 28667412 |
| Molecular Formula | C19H16BrNO4 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 3-bromo-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(Br)c2)cc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C19H16BrNO4/c1-24-17-7-5-14(10-16(17)18-8-6-15(11-22)25-18)21-19(23)12-3-2-4-13(20)9-12/h2-10,22H,11H2,1H3,(H,21,23) |
| InChIKey | IVTFQAMQYDVETH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |