C23H19NO4 — CID 28668742
N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]naphthalene-2-carboxamide (PubChem CID 28668742) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 28668742 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]naphthalene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc3ccccc3c2)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C23H19NO4/c1-27-22-13-18(8-10-20(22)21-11-9-19(14-25)28-21)24-23(26)17-7-6-15-4-2-3-5-16(15)12-17/h2-13,25H,14H2,1H3,(H,24,26) |
| InChIKey | RKHAUHGSHPIMKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |