C22H21NO5 — CID 28677867
(E)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 28677867) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is (E)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 28677867 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (E)-N-[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(OC)c(-c3ccc(CO)o3)c2)cc1 |
| InChI | InChI=1S/C22H21NO5/c1-26-17-7-3-15(4-8-17)5-12-22(25)23-16-6-10-20(27-2)19(13-16)21-11-9-18(14-24)28-21/h3-13,24H,14H2,1-2H3,(H,23,25)/b12-5+ |
| InChIKey | PCEPGGLCCWEMPU-LFYBBSHMSA-N |
| XLogP | 4.11 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|