C23H22ClNO5 — CID 28686589
(E)-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 28686589) has the molecular formula C23H22ClNO5 and a molecular weight of 427.88 g/mol. Its IUPAC name is (E)-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 28686589 |
| Molecular Formula | C23H22ClNO5 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (E)-N-[4-chloro-3-[5-(hydroxymethyl)furan-2-yl]phenyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2ccc(Cl)c(-c3ccc(CO)o3)c2)cc1OC |
| InChI | InChI=1S/C23H22ClNO5/c1-3-29-21-9-4-15(12-22(21)28-2)5-11-23(27)25-16-6-8-19(24)18(13-16)20-10-7-17(14-26)30-20/h4-13,26H,3,14H2,1-2H3,(H,25,27)/b11-5+ |
| InChIKey | SBCOQYYVORWZHH-VZUCSPMQSA-N |
| XLogP | 5.15 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|