C19H19Cl2NO3 — CID 5046140
N-(3,4-dichlorophenyl)-3-(3,4-diethoxyphenyl)prop-2-enamide (PubChem CID 5046140) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(3,4-diethoxyphenyl)prop-2-enamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(3,4-diethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5046140 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(3,4-diethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(C=CC(=O)Nc2ccc(Cl)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C19H19Cl2NO3/c1-3-24-17-9-5-13(11-18(17)25-4-2)6-10-19(23)22-14-7-8-15(20)16(21)12-14/h5-12H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | LNAYXYYCHYZAQJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|