C21H26N2O3 — CID 1178498
(E)-3-(3,4-diethoxyphenyl)-N-[4-(dimethylamino)phenyl]prop-2-enamide (PubChem CID 1178498) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (E)-3-(3,4-diethoxyphenyl)-N-[4-(dimethylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-diethoxyphenyl)-N-[4-(dimethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1178498 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (E)-3-(3,4-diethoxyphenyl)-N-[4-(dimethylamino)phenyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2ccc(N(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C21H26N2O3/c1-5-25-19-13-7-16(15-20(19)26-6-2)8-14-21(24)22-17-9-11-18(12-10-17)23(3)4/h7-15H,5-6H2,1-4H3,(H,22,24)/b14-8+ |
| InChIKey | WLCQGHOIFHXGOY-RIYZIHGNSA-N |
| XLogP | 4.20 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|