C21H19NO3 — CID 28677651
(E)-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]-3-phenylprop-2-enamide (PubChem CID 28677651) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is (E)-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 28677651 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (E)-N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methylphenyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccccc2)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C21H19NO3/c1-15-13-17(8-10-19(15)20-11-9-18(14-23)25-20)22-21(24)12-7-16-5-3-2-4-6-16/h2-13,23H,14H2,1H3,(H,22,24)/b12-7+ |
| InChIKey | RXASYJJDVCNZCD-KPKJPENVSA-N |
| XLogP | 4.40 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|