C20H16ClNO3 — CID 28677694
(E)-3-(4-chlorophenyl)-N-[4-[5-(hydroxymethyl)furan-2-yl]phenyl]prop-2-enamide (PubChem CID 28677694) has the molecular formula C20H16ClNO3 and a molecular weight of 353.81 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[4-[5-(hydroxymethyl)furan-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[4-[5-(hydroxymethyl)furan-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 28677694 |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[4-[5-(hydroxymethyl)furan-2-yl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Nc1ccc(-c2ccc(CO)o2)cc1 |
| InChI | InChI=1S/C20H16ClNO3/c21-16-6-1-14(2-7-16)3-12-20(24)22-17-8-4-15(5-9-17)19-11-10-18(13-23)25-19/h1-12,23H,13H2,(H,22,24)/b12-3+ |
| InChIKey | NNPLYMXHIHVSAH-KGVSQERTSA-N |
| XLogP | 4.74 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|