C24H25NO3 — CID 28677797
(E)-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 28677797) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (E)-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 28677797 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (E)-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methylphenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(CO)o2)cc1NC(=O)/C=C/c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C24H25NO3/c1-16(2)19-9-5-18(6-10-19)7-13-24(27)25-22-14-20(8-4-17(22)3)23-12-11-21(15-26)28-23/h4-14,16,26H,15H2,1-3H3,(H,25,27)/b13-7+ |
| InChIKey | XTARQBIKUIAQPL-NTUHNPAUSA-N |
| XLogP | 5.52 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|