C25H19ClN2O4S — CID 3270147
3-[5-(4-chlorophenyl)furan-2-yl]-N-[[3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3270147) has the molecular formula C25H19ClN2O4S and a molecular weight of 478.96 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3270147 |
| Molecular Formula | C25H19ClN2O4S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[[3-[5-(hydroxymethyl)furan-2-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1cccc(-c2ccc(CO)o2)c1 |
| InChI | InChI=1S/C25H19ClN2O4S/c26-18-6-4-16(5-7-18)22-11-8-20(31-22)10-13-24(30)28-25(33)27-19-3-1-2-17(14-19)23-12-9-21(15-29)32-23/h1-14,29H,15H2,(H2,27,28,30,33) |
| InChIKey | VJSLIEPEOZYLLG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|