C24H17ClN2O3S — CID 22782307
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide (PubChem CID 22782307) has the molecular formula C24H17ClN2O3S and a molecular weight of 448.93 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 22782307 |
| Molecular Formula | C24H17ClN2O3S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C24H17ClN2O3S/c25-16-9-7-15(8-10-16)22-13-11-17(30-22)12-14-23(29)27-24(31)26-20-5-1-4-19-18(20)3-2-6-21(19)28/h1-14,28H,(H2,26,27,29,31)/b14-12+ |
| InChIKey | ACUILYPUQHLETB-WYMLVPIESA-N |
| XLogP | 5.99 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|