C19H13BrClN3O2S — CID 17314103
(E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-chloro-3-pyridinyl)carbamothioyl]prop-2-enamide (PubChem CID 17314103) has the molecular formula C19H13BrClN3O2S and a molecular weight of 462.76 g/mol. Its IUPAC name is (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-chloro-3-pyridinyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-chloro-3-pyridinyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17314103 |
| Molecular Formula | C19H13BrClN3O2S |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-chloro-3-pyridinyl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Br)cc2)o1)NC(=S)Nc1cccnc1Cl |
| InChI | InChI=1S/C19H13BrClN3O2S/c20-13-5-3-12(4-6-13)16-9-7-14(26-16)8-10-17(25)24-19(27)23-15-2-1-11-22-18(15)21/h1-11H,(H2,23,24,25,27)/b10-8+ |
| InChIKey | ZRLCZOSVHWOTLW-CSKARUKUSA-N |
| XLogP | 5.28 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|