C24H18BrN3O2S — CID 17313447
(E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-methylquinolin-8-yl)carbamothioyl]prop-2-enamide (PubChem CID 17313447) has the molecular formula C24H18BrN3O2S and a molecular weight of 492.40 g/mol. Its IUPAC name is (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-methylquinolin-8-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-methylquinolin-8-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17313447 |
| Molecular Formula | C24H18BrN3O2S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-[(2-methylquinolin-8-yl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc2cccc(NC(=S)NC(=O)/C=C/c3ccc(-c4ccc(Br)cc4)o3)c2n1 |
| InChI | InChI=1S/C24H18BrN3O2S/c1-15-5-6-17-3-2-4-20(23(17)26-15)27-24(31)28-22(29)14-12-19-11-13-21(30-19)16-7-9-18(25)10-8-16/h2-14H,1H3,(H2,27,28,29,31)/b14-12+ |
| InChIKey | BGNLAKIPLWALEQ-WYMLVPIESA-N |
| XLogP | 6.09 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|