C24H18N2O3S — CID 17314022
(E)-N-[(2-hydroxynaphthalen-1-yl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide (PubChem CID 17314022) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is (E)-N-[(2-hydroxynaphthalen-1-yl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2-hydroxynaphthalen-1-yl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17314022 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (E)-N-[(2-hydroxynaphthalen-1-yl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)o1)NC(=S)Nc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C24H18N2O3S/c27-20-13-10-16-6-4-5-9-19(16)23(20)26-24(30)25-22(28)15-12-18-11-14-21(29-18)17-7-2-1-3-8-17/h1-15,27H,(H2,25,26,28,30)/b15-12+ |
| InChIKey | FLLJFTZGAZNJHM-NTCAYCPXSA-N |
| XLogP | 5.33 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|