C22H19ClN2O4S — CID 17336300
(E)-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide (PubChem CID 17336300) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is (E)-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17336300 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (E)-N-[(4-chloro-2,5-dimethoxyphenyl)carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
| SMILES | COc1cc(NC(=S)NC(=O)/C=C/c2ccc(-c3ccccc3)o2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H19ClN2O4S/c1-27-19-13-17(20(28-2)12-16(19)23)24-22(30)25-21(26)11-9-15-8-10-18(29-15)14-6-4-3-5-7-14/h3-13H,1-2H3,(H2,24,25,26,30)/b11-9+ |
| InChIKey | VUFBFCSWYIXODA-PKNBQFBNSA-N |
| XLogP | 5.14 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|