C26H19Cl2N3O5S — CID 17317199
N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide (PubChem CID 17317199) has the molecular formula C26H19Cl2N3O5S and a molecular weight of 556.43 g/mol. Its IUPAC name is N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17317199 |
| Molecular Formula | C26H19Cl2N3O5S |
| Molecular Weight | 556.43 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccco2)cc1NC(=S)NC(=O)/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C26H19Cl2N3O5S/c1-34-22-7-4-18(29-25(33)23-3-2-10-35-23)14-20(22)30-26(37)31-24(32)9-6-19-5-8-21(36-19)15-11-16(27)13-17(28)12-15/h2-14H,1H3,(H,29,33)(H2,30,31,32,37)/b9-6+ |
| InChIKey | NUABMJQFPXAUOI-RMKNXTFCSA-N |
| XLogP | 6.63 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|