C21H18ClN3O5S — CID 3676209
N-[3-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide (PubChem CID 3676209) has the molecular formula C21H18ClN3O5S and a molecular weight of 459.91 g/mol. Its IUPAC name is N-[3-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3676209 |
| Molecular Formula | C21H18ClN3O5S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | N-[3-[(3-chloro-4-methoxybenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cc(NC(=O)c3ccco3)ccc2OC)cc1Cl |
| InChI | InChI=1S/C21H18ClN3O5S/c1-28-16-7-5-12(10-14(16)22)19(26)25-21(31)24-15-11-13(6-8-17(15)29-2)23-20(27)18-4-3-9-30-18/h3-11H,1-2H3,(H,23,27)(H2,24,25,26,31) |
| InChIKey | XXKWBGFGCDTXFP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|