C23H21N3O5S — CID 17109707
N-[4-methoxy-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 17109707) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[4-methoxy-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-methoxy-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17109707 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-[4-methoxy-3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2cc(NC(=O)c3ccco3)ccc2OC)cc1 |
| InChI | InChI=1S/C23H21N3O5S/c1-29-17-9-5-15(6-10-17)7-12-21(27)26-23(32)25-18-14-16(8-11-19(18)30-2)24-22(28)20-4-3-13-31-20/h3-14H,1-2H3,(H,24,28)(H2,25,26,27,32)/b12-7+ |
| InChIKey | DXOOMEGFTSEGOW-KPKJPENVSA-N |
| XLogP | 4.08 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|