C20H16N4O6S — CID 2231983
N-[4-methoxy-3-[(2-nitrobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 2231983) has the molecular formula C20H16N4O6S and a molecular weight of 440.44 g/mol. Its IUPAC name is N-[4-methoxy-3-[(2-nitrobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-methoxy-3-[(2-nitrobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2231983 |
| Molecular Formula | C20H16N4O6S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[4-methoxy-3-[(2-nitrobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccco2)cc1NC(=S)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N4O6S/c1-29-16-9-8-12(21-19(26)17-7-4-10-30-17)11-14(16)22-20(31)23-18(25)13-5-2-3-6-15(13)24(27)28/h2-11H,1H3,(H,21,26)(H2,22,23,25,31) |
| InChIKey | XUGPIUBKWWYHDL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|