C20H16BrN3O4S — CID 5091898
N-[3-[(4-bromobenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide (PubChem CID 5091898) has the molecular formula C20H16BrN3O4S and a molecular weight of 474.34 g/mol. Its IUPAC name is N-[3-[(4-bromobenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(4-bromobenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5091898 |
| Molecular Formula | C20H16BrN3O4S |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | N-[3-[(4-bromobenzoyl)carbamothioylamino]-4-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccco2)cc1NC(=S)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16BrN3O4S/c1-27-16-9-8-14(22-19(26)17-3-2-10-28-17)11-15(16)23-20(29)24-18(25)12-4-6-13(21)7-5-12/h2-11H,1H3,(H,22,26)(H2,23,24,25,29) |
| InChIKey | PBJMQQJNBCBKIR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|