C19H14BrN3O3S — CID 1341400
N-[3-[(4-bromobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 1341400) has the molecular formula C19H14BrN3O3S and a molecular weight of 444.31 g/mol. Its IUPAC name is N-[3-[(4-bromobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(4-bromobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1341400 |
| Molecular Formula | C19H14BrN3O3S |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | N-[3-[(4-bromobenzoyl)carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(NC(=O)c2ccco2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14BrN3O3S/c20-13-8-6-12(7-9-13)17(24)23-19(27)22-15-4-1-3-14(11-15)21-18(25)16-5-2-10-26-16/h1-11H,(H,21,25)(H2,22,23,24,27) |
| InChIKey | YXCQEYHBIBUUSO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|