C23H23N3O5S — CID 26169355
N-[3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 26169355) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26169355 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2cccc(NC(=O)c3ccco3)c2)c1 |
| InChI | InChI=1S/C23H23N3O5S/c1-2-29-12-13-30-19-9-3-6-16(14-19)21(27)26-23(32)25-18-8-4-7-17(15-18)24-22(28)20-10-5-11-31-20/h3-11,14-15H,2,12-13H2,1H3,(H,24,28)(H2,25,26,27,32) |
| InChIKey | OKBVEIJPPBULLR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|