C21H26N2O4S — CID 17142797
N-[[3-(2-ethoxyethoxy)phenyl]carbamothioyl]-3-propan-2-yloxybenzamide (PubChem CID 17142797) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[[3-(2-ethoxyethoxy)phenyl]carbamothioyl]-3-propan-2-yloxybenzamide.
| Compound Name | N-[[3-(2-ethoxyethoxy)phenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17142797 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[[3-(2-ethoxyethoxy)phenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
| SMILES | CCOCCOc1cccc(NC(=S)NC(=O)c2cccc(OC(C)C)c2)c1 |
| InChI | InChI=1S/C21H26N2O4S/c1-4-25-11-12-26-18-9-6-8-17(14-18)22-21(28)23-20(24)16-7-5-10-19(13-16)27-15(2)3/h5-10,13-15H,4,11-12H2,1-3H3,(H2,22,23,24,28) |
| InChIKey | SVFSOLRTWWESSD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|