C26H24F3N3O4S — CID 43878311
3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 43878311) has the molecular formula C26H24F3N3O4S and a molecular weight of 531.56 g/mol. Its IUPAC name is 3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43878311 |
| Molecular Formula | C26H24F3N3O4S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 3-[[3-(2-ethoxyethoxy)benzoyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2cccc(C(=O)Nc3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C26H24F3N3O4S/c1-2-35-12-13-36-22-11-4-7-18(15-22)24(34)32-25(37)31-20-9-3-6-17(14-20)23(33)30-21-10-5-8-19(16-21)26(27,28)29/h3-11,14-16H,2,12-13H2,1H3,(H,30,33)(H2,31,32,34,37) |
| InChIKey | YVTQSECYMSKFIU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|