C30H24F3N3O4S — CID 43887343
3-(2-phenoxyethoxy)-N-[[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 43887343) has the molecular formula C30H24F3N3O4S and a molecular weight of 579.60 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)-N-[[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-(2-phenoxyethoxy)-N-[[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43887343 |
| Molecular Formula | C30H24F3N3O4S |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | 3-(2-phenoxyethoxy)-N-[[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C30H24F3N3O4S/c31-30(32,33)22-7-5-8-24(19-22)34-27(37)20-12-14-23(15-13-20)35-29(41)36-28(38)21-6-4-11-26(18-21)40-17-16-39-25-9-2-1-3-10-25/h1-15,18-19H,16-17H2,(H,34,37)(H2,35,36,38,41) |
| InChIKey | ZBNCZRMIXNDTME-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|