C28H28F3N3O3S — CID 43887334
4-[(4-hexoxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 43887334) has the molecular formula C28H28F3N3O3S and a molecular weight of 543.61 g/mol. Its IUPAC name is 4-[(4-hexoxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(4-hexoxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43887334 |
| Molecular Formula | C28H28F3N3O3S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 4-[(4-hexoxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(C(=O)Nc3cccc(C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C28H28F3N3O3S/c1-2-3-4-5-17-37-24-15-11-20(12-16-24)26(36)34-27(38)33-22-13-9-19(10-14-22)25(35)32-23-8-6-7-21(18-23)28(29,30)31/h6-16,18H,2-5,17H2,1H3,(H,32,35)(H2,33,34,36,38) |
| InChIKey | WOXSYQALYLHFBQ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|