C25H34N2O2S — CID 17138207
4-tert-butyl-N-[(3-heptoxyphenyl)carbamothioyl]benzamide (PubChem CID 17138207) has the molecular formula C25H34N2O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3-heptoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(3-heptoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17138207 |
| Molecular Formula | C25H34N2O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 4-tert-butyl-N-[(3-heptoxyphenyl)carbamothioyl]benzamide |
| SMILES | CCCCCCCOc1cccc(NC(=S)NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C25H34N2O2S/c1-5-6-7-8-9-17-29-22-12-10-11-21(18-22)26-24(30)27-23(28)19-13-15-20(16-14-19)25(2,3)4/h10-16,18H,5-9,17H2,1-4H3,(H2,26,27,28,30) |
| InChIKey | DTVRVSKKAHQAEC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|