C23H19F3N2O3 — CID 28639289
3-ethoxy-N-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide (PubChem CID 28639289) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is 3-ethoxy-N-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | 3-ethoxy-N-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 28639289 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3-ethoxy-N-[4-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]benzamide |
| SMILES | CCOc1cccc(C(=O)Nc2ccc(C(=O)Nc3cccc(C(F)(F)F)c3)cc2)c1 |
| InChI | InChI=1S/C23H19F3N2O3/c1-2-31-20-8-3-5-16(13-20)22(30)27-18-11-9-15(10-12-18)21(29)28-19-7-4-6-17(14-19)23(24,25)26/h3-14H,2H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | IGNOUUVFPHBPHA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |