C16H15F3N2O2 — CID 878376
1-(3-ethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 878376) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-ethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 878376 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-(3-ethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCOc1cccc(NC(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H15F3N2O2/c1-2-23-14-8-4-7-13(10-14)21-15(22)20-12-6-3-5-11(9-12)16(17,18)19/h3-10H,2H2,1H3,(H2,20,21,22) |
| InChIKey | RAUIXEBFSFZARB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |