C11H13F3N2O2 — CID 47332046
1-(3-ethoxyphenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47332046) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-ethoxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47332046 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(3-ethoxyphenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCOc1cccc(NC(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-2-18-9-5-3-4-8(6-9)16-10(17)15-7-11(12,13)14/h3-6H,2,7H2,1H3,(H2,15,16,17) |
| InChIKey | WQXVXCCXELAOSZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |